C22H17IN2O3S — CID 5089005
4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 5089005) has the molecular formula C22H17IN2O3S and a molecular weight of 516.36 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5089005 |
| Molecular Formula | C22H17IN2O3S |
| Molecular Weight | 516.36 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C)c(C(O)=C2C(=O)C(=O)N(c3nccs3)C2c2ccc(I)cc2)c1 |
| InChI | InChI=1S/C22H17IN2O3S/c1-12-3-4-13(2)16(11-12)19(26)17-18(14-5-7-15(23)8-6-14)25(21(28)20(17)27)22-24-9-10-29-22/h3-11,18,26H,1-2H3 |
| InChIKey | LAADWYFUFUDKMS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|