C20H16N2O4S — CID 6267129
(4E)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 6267129) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is (4E)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6267129 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (4E)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C)c(/C(O)=C2\C(=O)C(=O)N(c3nccs3)C2c2ccco2)c1 |
| InChI | InChI=1S/C20H16N2O4S/c1-11-5-6-12(2)13(10-11)17(23)15-16(14-4-3-8-26-14)22(19(25)18(15)24)20-21-7-9-27-20/h3-10,16,23H,1-2H3/b17-15+ |
| InChIKey | YEEWPFYBCBBIID-BMRADRMJSA-N |
| XLogP | 3.98 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|