C17H19Cl2N3O4S — CID 50894459
2,5-dichloro-N-(2-hydrazinyl-2-oxoethyl)-N-(4-propoxyphenyl)benzenesulfonamide (PubChem CID 50894459) has the molecular formula C17H19Cl2N3O4S and a molecular weight of 432.33 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-hydrazinyl-2-oxoethyl)-N-(4-propoxyphenyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2-hydrazinyl-2-oxoethyl)-N-(4-propoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50894459 |
| Molecular Formula | C17H19Cl2N3O4S |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2,5-dichloro-N-(2-hydrazinyl-2-oxoethyl)-N-(4-propoxyphenyl)benzenesulfonamide |
| SMILES | CCCOc1ccc(N(CC(=O)NN)S(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2N3O4S/c1-2-9-26-14-6-4-13(5-7-14)22(11-17(23)21-20)27(24,25)16-10-12(18)3-8-15(16)19/h3-8,10H,2,9,11,20H2,1H3,(H,21,23) |
| InChIKey | HJQKIYSOEZUBCU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|