C18H20FNO5S — CID 50894823
methyl 2-(N-(4-fluorophenyl)sulfonyl-4-propoxyanilino)acetate (PubChem CID 50894823) has the molecular formula C18H20FNO5S and a molecular weight of 381.43 g/mol. Its IUPAC name is methyl 2-(N-(4-fluorophenyl)sulfonyl-4-propoxyanilino)acetate.
| Compound Name | methyl 2-(N-(4-fluorophenyl)sulfonyl-4-propoxyanilino)acetate |
|---|---|
| PubChem CID | 50894823 |
| Molecular Formula | C18H20FNO5S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | methyl 2-(N-(4-fluorophenyl)sulfonyl-4-propoxyanilino)acetate |
| SMILES | CCCOc1ccc(N(CC(=O)OC)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H20FNO5S/c1-3-12-25-16-8-6-15(7-9-16)20(13-18(21)24-2)26(22,23)17-10-4-14(19)5-11-17/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | PJCKCTWWRXQAMT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |