C28H39N3O10S — CID 50896346
bis((Z)-but-2-enedioic acid);2-(4-methylphenyl)sulfonyl-5-(3-piperidin-1-ylpropyl)-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 50896346) has the molecular formula C28H39N3O10S and a molecular weight of 609.70 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);2-(4-methylphenyl)sulfonyl-5-(3-piperidin-1-ylpropyl)-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | bis((Z)-but-2-enedioic acid);2-(4-methylphenyl)sulfonyl-5-(3-piperidin-1-ylpropyl)-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 50896346 |
| Molecular Formula | C28H39N3O10S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);2-(4-methylphenyl)sulfonyl-5-(3-piperidin-1-ylpropyl)-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3CC2CN3CCCN2CCCCC2)cc1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H31N3O2S.2C4H4O4/c1-17-6-8-20(9-7-17)26(24,25)23-16-18-14-19(23)15-22(18)13-5-12-21-10-3-2-4-11-21;2*5-3(6)1-2-4(7)8/h6-9,18-19H,2-5,10-16H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | WZZRWBQYZWYUOL-SPIKMXEPSA-N |
| XLogP | 1.74 |
| TPSA | 193.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|