C15H19NO5 — CID 50900716
(2R,3S)-3-methoxy-2-[methyl(phenylmethoxycarbonyl)amino]pent-4-enoic acid (PubChem CID 50900716) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is (2R,3S)-3-methoxy-2-[methyl(phenylmethoxycarbonyl)amino]pent-4-enoic acid.
| Compound Name | (2R,3S)-3-methoxy-2-[methyl(phenylmethoxycarbonyl)amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 50900716 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (2R,3S)-3-methoxy-2-[methyl(phenylmethoxycarbonyl)amino]pent-4-enoic acid |
| SMILES | C=C[C@H](OC)[C@H](C(=O)O)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H19NO5/c1-4-12(20-3)13(14(17)18)16(2)15(19)21-10-11-8-6-5-7-9-11/h4-9,12-13H,1,10H2,2-3H3,(H,17,18)/t12-,13+/m0/s1 |
| InChIKey | ZCNVDYRUTZDQSW-QWHCGFSZSA-N |
| XLogP | 1.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|