C24H28O2 — CID 50900992
(3R,4Z)-3-butyl-3-phenyl-4-(1-phenylpentylidene)oxetan-2-one (PubChem CID 50900992) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (3R,4Z)-3-butyl-3-phenyl-4-(1-phenylpentylidene)oxetan-2-one.
| Compound Name | (3R,4Z)-3-butyl-3-phenyl-4-(1-phenylpentylidene)oxetan-2-one |
|---|---|
| PubChem CID | 50900992 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (3R,4Z)-3-butyl-3-phenyl-4-(1-phenylpentylidene)oxetan-2-one |
| SMILES | CCCC/C(=C1/OC(=O)[C@]1(CCCC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28O2/c1-3-5-17-21(19-13-9-7-10-14-19)22-24(18-6-4-2,23(25)26-22)20-15-11-8-12-16-20/h7-16H,3-6,17-18H2,1-2H3/b22-21-/t24-/m1/s1 |
| InChIKey | YTYWLUOYFISIRZ-GFXIQCROSA-N |
| XLogP | 6.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|