C28H28F3N5O12S3 — CID 50901692
[(2R,3R,4R)-2-(6-benzamidopurin-9-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate (PubChem CID 50901692) has the molecular formula C28H28F3N5O12S3 and a molecular weight of 779.75 g/mol. Its IUPAC name is [(2R,3R,4R)-2-(6-benzamidopurin-9-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,3R,4R)-2-(6-benzamidopurin-9-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 50901692 |
| Molecular Formula | C28H28F3N5O12S3 |
| Molecular Weight | 779.75 g/mol |
| Exact Mass | 779.08 |
| IUPAC Name | [(2R,3R,4R)-2-(6-benzamidopurin-9-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CS(=O)(=O)OCC1(COS(C)(=O)=O)O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](OS(=O)(=O)C(F)(F)F)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H28F3N5O12S3/c1-49(38,39)45-14-27(15-46-50(2,40)41)22(44-13-18-9-5-3-6-10-18)21(48-51(42,43)28(29,30)31)26(47-27)36-17-34-20-23(32-16-33-24(20)36)35-25(37)19-11-7-4-8-12-19/h3-12,16-17,21-22,26H,13-15H2,1-2H3,(H,32,33,35,37)/t21-,22-,26-/m1/s1 |
| InChIKey | XEMQDCNQVUEUHF-XLGIIRLISA-N |
| XLogP | 2.12 |
| TPSA | 221.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|