C16H24FNO7 — CID 50902793
cis-methyl (1S,2S)-1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoro-2-formylcyclopropane-1-carboxylate (PubChem CID 50902793) has the molecular formula C16H24FNO7 and a molecular weight of 361.37 g/mol. Its IUPAC name is cis-methyl (1S,2S)-1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoro-2-formylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1S,2S)-1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoro-2-formylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 50902793 |
| Molecular Formula | C16H24FNO7 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | cis-methyl (1S,2S)-1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoro-2-formylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C[C@@]1(F)C=O |
| InChI | InChI=1S/C16H24FNO7/c1-13(2,3)24-11(21)18(12(22)25-14(4,5)6)16(10(20)23-7)8-15(16,17)9-19/h9H,8H2,1-7H3/t15-,16+/m1/s1 |
| InChIKey | XUHXRIPFGUIYCN-CVEARBPZSA-N |
| XLogP | 2.38 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|