C16H25BrFNO6 — CID 50902884
methyl 1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(bromomethyl)-2-fluorocyclopropane-1-carboxylate (PubChem CID 50902884) has the molecular formula C16H25BrFNO6 and a molecular weight of 426.28 g/mol. Its IUPAC name is methyl 1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(bromomethyl)-2-fluorocyclopropane-1-carboxylate.
| Compound Name | methyl 1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(bromomethyl)-2-fluorocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 50902884 |
| Molecular Formula | C16H25BrFNO6 |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | methyl 1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(bromomethyl)-2-fluorocyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)CC1(F)CBr |
| InChI | InChI=1S/C16H25BrFNO6/c1-13(2,3)24-11(21)19(12(22)25-14(4,5)6)16(10(20)23-7)8-15(16,18)9-17/h8-9H2,1-7H3 |
| InChIKey | JMGCUZOCFXTRLO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|