C18H25FN2O6 — CID 71528493
trans-methyl (1R,2R)-1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[(E)-2-cyanoethenyl]-2-fluorocyclopropane-1-carboxylate (PubChem CID 71528493) has the molecular formula C18H25FN2O6 and a molecular weight of 384.40 g/mol. Its IUPAC name is trans-methyl (1R,2R)-1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[(E)-2-cyanoethenyl]-2-fluorocyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1R,2R)-1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[(E)-2-cyanoethenyl]-2-fluorocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71528493 |
| Molecular Formula | C18H25FN2O6 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | trans-methyl (1R,2R)-1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[(E)-2-cyanoethenyl]-2-fluorocyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C[C@@]1(F)/C=C/C#N |
| InChI | InChI=1S/C18H25FN2O6/c1-15(2,3)26-13(23)21(14(24)27-16(4,5)6)18(12(22)25-7)11-17(18,19)9-8-10-20/h8-9H,11H2,1-7H3/b9-8+/t17-,18+/m0/s1 |
| InChIKey | FYBBBBGELHWMQX-CWDJHMJFSA-N |
| XLogP | 3.26 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|