C19H18BrNO5 — CID 5090353
methyl 5-bromo-2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzoate (PubChem CID 5090353) has the molecular formula C19H18BrNO5 and a molecular weight of 420.26 g/mol. Its IUPAC name is methyl 5-bromo-2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzoate.
| Compound Name | methyl 5-bromo-2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 5090353 |
| Molecular Formula | C19H18BrNO5 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | methyl 5-bromo-2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzoate |
| SMILES | COC(=O)c1cc(Br)ccc1NC(=O)C=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H18BrNO5/c1-24-16-8-4-12(10-17(16)25-2)5-9-18(22)21-15-7-6-13(20)11-14(15)19(23)26-3/h4-11H,1-3H3,(H,21,22) |
| InChIKey | AFBVTCVPTNRVAE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|