C22H32BN10O17P5 — CID 50915195
CID 50915195 (PubChem CID 50915195) has the molecular formula C22H32BN10O17P5 and a molecular weight of 874.23 g/mol.
| Compound Name | CID 50915195 |
|---|---|
| PubChem CID | 50915195 |
| Molecular Formula | C22H32BN10O17P5 |
| Molecular Weight | 874.23 g/mol |
| Exact Mass | 874.07 |
| IUPAC Name | — |
| SMILES | [B]P(=O)(OP(=O)(O)CP(=O)(O)OC[C@@H]1O[C@H](n2cnc3c(N)ncnc32)C[C@H]1O)OP(=O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C22H32BN10O17P5/c23-55(44,49-53(40,41)9-51(36,37)45-3-13-11(34)1-15(47-13)32-7-30-17-19(24)26-5-28-21(17)32)50-54(42,43)10-52(38,39)46-4-14-12(35)2-16(48-14)33-8-31-18-20(25)27-6-29-22(18)33/h5-8,11-16,34-35H,1-4,9-10H2,(H,36,37)(H,38,39)(H,40,41)(H,42,43)(H2,24,26,28)(H2,25,27,29)/t11-,12+,13+,14-,15+,16-,55? |
| InChIKey | IQYFXHBXILYDNN-PMDYCUPCSA-N |
| XLogP | 0.13 |
| TPSA | 401.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|