C15H11ClF2O3S — CID 50915349
[1-(4-chlorophenyl)-2,2-difluoroethenyl] 4-methylbenzenesulfonate (PubChem CID 50915349) has the molecular formula C15H11ClF2O3S and a molecular weight of 344.77 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2,2-difluoroethenyl] 4-methylbenzenesulfonate.
| Compound Name | [1-(4-chlorophenyl)-2,2-difluoroethenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 50915349 |
| Molecular Formula | C15H11ClF2O3S |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | [1-(4-chlorophenyl)-2,2-difluoroethenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=C(F)F)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H11ClF2O3S/c1-10-2-8-13(9-3-10)22(19,20)21-14(15(17)18)11-4-6-12(16)7-5-11/h2-9H,1H3 |
| InChIKey | DESRIZJOGRZWKU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|