C17H16N2O6 — CID 50915752
dimethyl 3-(4-methoxycarbonylanilino)pyridine-2,4-dicarboxylate (PubChem CID 50915752) has the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. Its IUPAC name is dimethyl 3-(4-methoxycarbonylanilino)pyridine-2,4-dicarboxylate.
| Compound Name | dimethyl 3-(4-methoxycarbonylanilino)pyridine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 50915752 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | dimethyl 3-(4-methoxycarbonylanilino)pyridine-2,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(Nc2c(C(=O)OC)ccnc2C(=O)OC)cc1 |
| InChI | InChI=1S/C17H16N2O6/c1-23-15(20)10-4-6-11(7-5-10)19-13-12(16(21)24-2)8-9-18-14(13)17(22)25-3/h4-9,19H,1-3H3 |
| InChIKey | XMNTUPNSMMLWAW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|