C24H41NO3Si — CID 50916572
(3R,5S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylbutyl]-5-(2-methylpropyl)pyrrolidin-2-one (PubChem CID 50916572) has the molecular formula C24H41NO3Si and a molecular weight of 419.68 g/mol. Its IUPAC name is (3R,5S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylbutyl]-5-(2-methylpropyl)pyrrolidin-2-one.
| Compound Name | (3R,5S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylbutyl]-5-(2-methylpropyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 50916572 |
| Molecular Formula | C24H41NO3Si |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | (3R,5S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylbutyl]-5-(2-methylpropyl)pyrrolidin-2-one |
| SMILES | CC(C)C[C@H]1C[C@H]([C@@H](CC(O)Cc2ccccc2)O[Si](C)(C)C(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C24H41NO3Si/c1-17(2)13-19-15-21(23(27)25-19)22(28-29(6,7)24(3,4)5)16-20(26)14-18-11-9-8-10-12-18/h8-12,17,19-22,26H,13-16H2,1-7H3,(H,25,27)/t19-,20?,21+,22+/m0/s1 |
| InChIKey | ROMAVLINIVSNQE-XWDTXVGXSA-N |
| XLogP | 4.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|