C27H28N6O2 — CID 50916759
N-[(4-nitrophenyl)diazenyl]-1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine (PubChem CID 50916759) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is N-[(4-nitrophenyl)diazenyl]-1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine.
| Compound Name | N-[(4-nitrophenyl)diazenyl]-1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine |
|---|---|
| PubChem CID | 50916759 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-[(4-nitrophenyl)diazenyl]-1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine |
| SMILES | Cc1cc(C)c(-n2ccn(-c3c(C)cc(C)cc3C)c2=N/N=N/c2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C27H28N6O2/c1-17-13-19(3)25(20(4)14-17)31-11-12-32(26-21(5)15-18(2)16-22(26)6)27(31)29-30-28-23-7-9-24(10-8-23)33(34)35/h7-16H,1-6H3/b30-28+ |
| InChIKey | ZTTAQNVVXZQPPD-SJCQXOIGSA-N |
| XLogP | 6.63 |
| TPSA | 90.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|