C33H33FeNO5 — CID 50918749
cyclopenta-1,3-diene;diethyl 1-(4-cyclopenta-2,4-dien-1-ylphenyl)-4-(furan-2-yl)-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate;iron(2+) (PubChem CID 50918749) has the molecular formula C33H33FeNO5 and a molecular weight of 579.47 g/mol. Its IUPAC name is cyclopenta-1,3-diene;diethyl 1-(4-cyclopenta-2,4-dien-1-ylphenyl)-4-(furan-2-yl)-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;diethyl 1-(4-cyclopenta-2,4-dien-1-ylphenyl)-4-(furan-2-yl)-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate;iron(2+) |
|---|---|
| PubChem CID | 50918749 |
| Molecular Formula | C33H33FeNO5 |
| Molecular Weight | 579.47 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | cyclopenta-1,3-diene;diethyl 1-(4-cyclopenta-2,4-dien-1-ylphenyl)-4-(furan-2-yl)-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate;iron(2+) |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(-[c-]3cccc3)cc2)C(C)=C(C(=O)OCC)C1c1ccco1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C28H28NO5.C5H5.Fe/c1-5-32-27(30)24-18(3)29(22-15-13-21(14-16-22)20-10-7-8-11-20)19(4)25(28(31)33-6-2)26(24)23-12-9-17-34-23;1-2-4-5-3-1;/h7-17,26H,5-6H2,1-4H3;1-5H;/q2*-1;+2 |
| InChIKey | DCHHTSKOBUMXRO-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.47 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|