C17H24O5 — CID 50918808
[(1S,2S,4R,7S,9S,10R)-4-hydroxy-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-10-yl] acetate (PubChem CID 50918808) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(1S,2S,4R,7S,9S,10R)-4-hydroxy-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-10-yl] acetate.
| Compound Name | [(1S,2S,4R,7S,9S,10R)-4-hydroxy-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-10-yl] acetate |
|---|---|
| PubChem CID | 50918808 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(1S,2S,4R,7S,9S,10R)-4-hydroxy-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-10-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@]2(C)C3(CO3)[C@H]1O[C@H]1C=C(C)[C@H](O)C[C@]12C |
| InChI | InChI=1S/C17H24O5/c1-9-5-13-15(3,6-11(9)19)16(4)7-12(21-10(2)18)14(22-13)17(16)8-20-17/h5,11-14,19H,6-8H2,1-4H3/t11-,12-,13+,14+,15-,16+,17?/m1/s1 |
| InChIKey | NQHODXMQWISCDQ-GKLXLLAYSA-N |
| XLogP | 1.58 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|