C24H26Cl2O8 — CID 87891468
[(1R,2R,3S,4R,7R,9R,10R,12S)-10-acetyloxy-3,4-dihydroxy-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl 2,4-dichlorobenzoate (PubChem CID 87891468) has the molecular formula C24H26Cl2O8 and a molecular weight of 513.37 g/mol. Its IUPAC name is [(1R,2R,3S,4R,7R,9R,10R,12S)-10-acetyloxy-3,4-dihydroxy-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl 2,4-dichlorobenzoate.
| Compound Name | [(1R,2R,3S,4R,7R,9R,10R,12S)-10-acetyloxy-3,4-dihydroxy-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 87891468 |
| Molecular Formula | C24H26Cl2O8 |
| Molecular Weight | 513.37 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | [(1R,2R,3S,4R,7R,9R,10R,12S)-10-acetyloxy-3,4-dihydroxy-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl 2,4-dichlorobenzoate |
| SMILES | CC(=O)O[C@@H]1C[C@]2(C)[C@@]3(COC(=O)c4ccc(Cl)cc4Cl)[C@H](O)[C@H](O)C(C)=C[C@H]3O[C@H]1[C@@]21CO1 |
| InChI | InChI=1S/C24H26Cl2O8/c1-11-6-17-23(19(29)18(11)28,9-31-21(30)14-5-4-13(25)7-15(14)26)22(3)8-16(33-12(2)27)20(34-17)24(22)10-32-24/h4-7,16-20,28-29H,8-10H2,1-3H3/t16-,17-,18-,19-,20-,22-,23-,24+/m1/s1 |
| InChIKey | JLYAXFPTMJOTLB-SIIXHCRKSA-N |
| XLogP | 2.70 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|