C24H28O7 — CID 10296179
[(1R,2S,7S,9R,14R)-1,9-dimethyl-8-oxo-5-phenylspiro[4,6,12-trioxatetracyclo[11.2.1.02,7.02,11]hexadecane-16,2'-oxirane]-14-yl] acetate (PubChem CID 10296179) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is [(1R,2S,7S,9R,14R)-1,9-dimethyl-8-oxo-5-phenylspiro[4,6,12-trioxatetracyclo[11.2.1.02,7.02,11]hexadecane-16,2'-oxirane]-14-yl] acetate.
| Compound Name | [(1R,2S,7S,9R,14R)-1,9-dimethyl-8-oxo-5-phenylspiro[4,6,12-trioxatetracyclo[11.2.1.02,7.02,11]hexadecane-16,2'-oxirane]-14-yl] acetate |
|---|---|
| PubChem CID | 10296179 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | [(1R,2S,7S,9R,14R)-1,9-dimethyl-8-oxo-5-phenylspiro[4,6,12-trioxatetracyclo[11.2.1.02,7.02,11]hexadecane-16,2'-oxirane]-14-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(C)C3(CO3)C1OC1C[C@@H](C)C(=O)[C@H]3OC(c4ccccc4)OC[C@@]132 |
| InChI | InChI=1S/C24H28O7/c1-13-9-17-23(11-27-21(31-20(23)18(13)26)15-7-5-4-6-8-15)22(3)10-16(29-14(2)25)19(30-17)24(22)12-28-24/h4-8,13,16-17,19-21H,9-12H2,1-3H3/t13-,16-,17?,19?,20-,21?,22-,23-,24?/m1/s1 |
| InChIKey | KXAFRICJLPNHPG-JXBIZYFGSA-N |
| XLogP | 2.57 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|