C17H20O7 — CID 11056799
methyl (3aR,5S,7R,7aR)-7-acetyloxy-5-hydroxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate (PubChem CID 11056799) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is methyl (3aR,5S,7R,7aR)-7-acetyloxy-5-hydroxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aR,5S,7R,7aR)-7-acetyloxy-5-hydroxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 11056799 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | methyl (3aR,5S,7R,7aR)-7-acetyloxy-5-hydroxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)[C@@]1(O)C[C@@H](OC(C)=O)[C@@H]2OC(c3ccccc3)O[C@@H]2C1 |
| InChI | InChI=1S/C17H20O7/c1-10(18)22-12-8-17(20,16(19)21-2)9-13-14(12)24-15(23-13)11-6-4-3-5-7-11/h3-7,12-15,20H,8-9H2,1-2H3/t12-,13-,14+,15?,17-/m1/s1 |
| InChIKey | QEKKEDYOJQLHEG-JPHNIFDFSA-N |
| XLogP | 1.10 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |