C18H20O8 — CID 135022464
[(3R,9S)-3-methoxy-5-oxo-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-8-yl] acetate (PubChem CID 135022464) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is [(3R,9S)-3-methoxy-5-oxo-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-8-yl] acetate.
| Compound Name | [(3R,9S)-3-methoxy-5-oxo-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-8-yl] acetate |
|---|---|
| PubChem CID | 135022464 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | [(3R,9S)-3-methoxy-5-oxo-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-8-yl] acetate |
| SMILES | CO[C@@]12CC(=O)OC1C(OC(C)=O)[C@H]1OC(c3ccccc3)OCC1O2 |
| InChI | InChI=1S/C18H20O8/c1-10(19)23-15-14-12(26-18(21-2)8-13(20)24-16(15)18)9-22-17(25-14)11-6-4-3-5-7-11/h3-7,12,14-17H,8-9H2,1-2H3/t12?,14-,15?,16?,17?,18+/m0/s1 |
| InChIKey | SRXIUYQHCDPJEJ-LKWYEHBWSA-N |
| XLogP | 1.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |