C16H21NO6 — CID 10990925
[(1R,2R,3R,5S)-5-(benzylcarbamoyl)-2,3,5-trihydroxycyclohexyl] acetate (PubChem CID 10990925) has the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. Its IUPAC name is [(1R,2R,3R,5S)-5-(benzylcarbamoyl)-2,3,5-trihydroxycyclohexyl] acetate.
| Compound Name | [(1R,2R,3R,5S)-5-(benzylcarbamoyl)-2,3,5-trihydroxycyclohexyl] acetate |
|---|---|
| PubChem CID | 10990925 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | [(1R,2R,3R,5S)-5-(benzylcarbamoyl)-2,3,5-trihydroxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@](O)(C(=O)NCc2ccccc2)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H21NO6/c1-10(18)23-13-8-16(22,7-12(19)14(13)20)15(21)17-9-11-5-3-2-4-6-11/h2-6,12-14,19-20,22H,7-9H2,1H3,(H,17,21)/t12-,13-,14-,16+/m1/s1 |
| InChIKey | RTOCLMGOSYZURD-KQTLUZQSSA-N |
| XLogP | -0.52 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |