C35H33N3O5 — CID 50919247
tert-butyl 2-[4-[[5-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoate (PubChem CID 50919247) has the molecular formula C35H33N3O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is tert-butyl 2-[4-[[5-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[5-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 50919247 |
| Molecular Formula | C35H33N3O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | tert-butyl 2-[4-[[5-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoate |
| SMILES | C[C@H](NC(=O)c1ccc2c(ccn2Cc2ccc(-c3ccccc3C(=O)OC(C)(C)C)cc2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H33N3O5/c1-23(25-13-16-29(17-14-25)38(41)42)36-33(39)28-15-18-32-27(21-28)19-20-37(32)22-24-9-11-26(12-10-24)30-7-5-6-8-31(30)34(40)43-35(2,3)4/h5-21,23H,22H2,1-4H3,(H,36,39)/t23-/m0/s1 |
| InChIKey | SVNUBTBREFLTRB-QHCPKHFHSA-N |
| XLogP | 7.71 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|