C22H27N5O3 — CID 50923114
5-(2-methoxyethylamino)-3-methyl-7-[4-[(2R)-2-methylmorpholin-4-yl]phenyl]pyrido[4,3-d]pyrimidin-4-one (PubChem CID 50923114) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 5-(2-methoxyethylamino)-3-methyl-7-[4-[(2R)-2-methylmorpholin-4-yl]phenyl]pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 5-(2-methoxyethylamino)-3-methyl-7-[4-[(2R)-2-methylmorpholin-4-yl]phenyl]pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 50923114 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 5-(2-methoxyethylamino)-3-methyl-7-[4-[(2R)-2-methylmorpholin-4-yl]phenyl]pyrido[4,3-d]pyrimidin-4-one |
| SMILES | COCCNc1nc(-c2ccc(N3CCO[C@H](C)C3)cc2)cc2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C22H27N5O3/c1-15-13-27(9-11-30-15)17-6-4-16(5-7-17)18-12-19-20(22(28)26(2)14-24-19)21(25-18)23-8-10-29-3/h4-7,12,14-15H,8-11,13H2,1-3H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | QUAKMLDDXYVWFX-OAHLLOKOSA-N |
| XLogP | 2.28 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|