C22H38O4Si — CID 50923352
ethyl (4S,5aS,10aR)-5-ethoxy-5-trimethylsilyloxy-2,3,4,5a,6,7,8,9,10,10a-decahydro-1H-cyclohepta[e]indene-4-carboxylate (PubChem CID 50923352) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is ethyl (4S,5aS,10aR)-5-ethoxy-5-trimethylsilyloxy-2,3,4,5a,6,7,8,9,10,10a-decahydro-1H-cyclohepta[e]indene-4-carboxylate.
| Compound Name | ethyl (4S,5aS,10aR)-5-ethoxy-5-trimethylsilyloxy-2,3,4,5a,6,7,8,9,10,10a-decahydro-1H-cyclohepta[e]indene-4-carboxylate |
|---|---|
| PubChem CID | 50923352 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ethyl (4S,5aS,10aR)-5-ethoxy-5-trimethylsilyloxy-2,3,4,5a,6,7,8,9,10,10a-decahydro-1H-cyclohepta[e]indene-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1C2=C(CCC2)[C@@H]2CCCCC[C@@H]2C1(OCC)O[Si](C)(C)C |
| InChI | InChI=1S/C22H38O4Si/c1-6-24-21(23)20-18-14-11-13-16(18)17-12-9-8-10-15-19(17)22(20,25-7-2)26-27(3,4)5/h17,19-20H,6-15H2,1-5H3/t17-,19-,20+,22?/m0/s1 |
| InChIKey | VKQVRPTWXWJWAH-SNKXLLSNSA-N |
| XLogP | 5.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|