C18H18F3NO4 — CID 50923786
[2-[3-[4-(trifluoromethyl)phenoxy]propoxy]phenyl] N-methylcarbamate (PubChem CID 50923786) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is [2-[3-[4-(trifluoromethyl)phenoxy]propoxy]phenyl] N-methylcarbamate.
| Compound Name | [2-[3-[4-(trifluoromethyl)phenoxy]propoxy]phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 50923786 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [2-[3-[4-(trifluoromethyl)phenoxy]propoxy]phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccccc1OCCCOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F3NO4/c1-22-17(23)26-16-6-3-2-5-15(16)25-12-4-11-24-14-9-7-13(8-10-14)18(19,20)21/h2-3,5-10H,4,11-12H2,1H3,(H,22,23) |
| InChIKey | NPWZTVWKWZHDCV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|