C17H15F3N2O5 — CID 67327744
[4-(trifluoromethyl)phenyl] N-(methoxycarbonylamino)-N-(2-methoxyphenyl)carbamate (PubChem CID 67327744) has the molecular formula C17H15F3N2O5 and a molecular weight of 384.31 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] N-(methoxycarbonylamino)-N-(2-methoxyphenyl)carbamate.
| Compound Name | [4-(trifluoromethyl)phenyl] N-(methoxycarbonylamino)-N-(2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 67327744 |
| Molecular Formula | C17H15F3N2O5 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] N-(methoxycarbonylamino)-N-(2-methoxyphenyl)carbamate |
| SMILES | COC(=O)NN(C(=O)Oc1ccc(C(F)(F)F)cc1)c1ccccc1OC |
| InChI | InChI=1S/C17H15F3N2O5/c1-25-14-6-4-3-5-13(14)22(21-15(23)26-2)16(24)27-12-9-7-11(8-10-12)17(18,19)20/h3-10H,1-2H3,(H,21,23) |
| InChIKey | GPESIORGOYWVDM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|