C17H20N4S — CID 509248
5-methyl-6-(4-phenylbutyl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 509248) has the molecular formula C17H20N4S and a molecular weight of 312.44 g/mol. Its IUPAC name is 5-methyl-6-(4-phenylbutyl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 5-methyl-6-(4-phenylbutyl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 509248 |
| Molecular Formula | C17H20N4S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-methyl-6-(4-phenylbutyl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cc1c(CCCCc2ccccc2)sc2nc(N)nc(N)c12 |
| InChI | InChI=1S/C17H20N4S/c1-11-13(10-6-5-9-12-7-3-2-4-8-12)22-16-14(11)15(18)20-17(19)21-16/h2-4,7-8H,5-6,9-10H2,1H3,(H4,18,19,20,21) |
| InChIKey | WNMFPFQVJDLOAT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|