C17H22F11NO — CID 5092805
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-dipentylcyclohexane-1-carboxamide (PubChem CID 5092805) has the molecular formula C17H22F11NO and a molecular weight of 465.35 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-dipentylcyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-dipentylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 5092805 |
| Molecular Formula | C17H22F11NO |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-dipentylcyclohexane-1-carboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17H22F11NO/c1-3-5-7-9-29(10-8-6-4-2)11(30)12(18)13(19,20)15(23,24)17(27,28)16(25,26)14(12,21)22/h3-10H2,1-2H3 |
| InChIKey | YHIIPBYNGYHGFA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|