C19H23BrN4OS — CID 50928697
N-(4-bromophenyl)-2-[6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]sulfanylacetamide (PubChem CID 50928697) has the molecular formula C19H23BrN4OS and a molecular weight of 435.39 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]sulfanylacetamide.
| Compound Name | N-(4-bromophenyl)-2-[6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 50928697 |
| Molecular Formula | C19H23BrN4OS |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-(4-bromophenyl)-2-[6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]sulfanylacetamide |
| SMILES | CCC1CCCCN1c1cc(SCC(=O)Nc2ccc(Br)cc2)ncn1 |
| InChI | InChI=1S/C19H23BrN4OS/c1-2-16-5-3-4-10-24(16)17-11-19(22-13-21-17)26-12-18(25)23-15-8-6-14(20)7-9-15/h6-9,11,13,16H,2-5,10,12H2,1H3,(H,23,25) |
| InChIKey | YNKXAZAQLAZAHY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |