C19H23FN4OS — CID 53136807
2-[6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]sulfanyl-N-(2-fluorophenyl)acetamide (PubChem CID 53136807) has the molecular formula C19H23FN4OS and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]sulfanyl-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]sulfanyl-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 53136807 |
| Molecular Formula | C19H23FN4OS |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]sulfanyl-N-(2-fluorophenyl)acetamide |
| SMILES | CCC1CCCCN1c1cc(SCC(=O)Nc2ccccc2F)ncn1 |
| InChI | InChI=1S/C19H23FN4OS/c1-2-14-7-5-6-10-24(14)17-11-19(22-13-21-17)26-12-18(25)23-16-9-4-3-8-15(16)20/h3-4,8-9,11,13-14H,2,5-7,10,12H2,1H3,(H,23,25) |
| InChIKey | YZYUIUCFTXVBGZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |