C19H18N4OS — CID 5092972
11-methyl-2-oxo-N-phenyl-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-5-carbothioamide (PubChem CID 5092972) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 11-methyl-2-oxo-N-phenyl-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-5-carbothioamide.
| Compound Name | 11-methyl-2-oxo-N-phenyl-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-5-carbothioamide |
|---|---|
| PubChem CID | 5092972 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 11-methyl-2-oxo-N-phenyl-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-5-carbothioamide |
| SMILES | Cc1cccn2c(=O)c3c(nc12)CCN(C(=S)Nc1ccccc1)C3 |
| InChI | InChI=1S/C19H18N4OS/c1-13-6-5-10-23-17(13)21-16-9-11-22(12-15(16)18(23)24)19(25)20-14-7-3-2-4-8-14/h2-8,10H,9,11-12H2,1H3,(H,20,25) |
| InChIKey | SEOTWCNLNYWHGH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|