C19H17ClN4OS — CID 3881437
N-(4-chlorophenyl)-14-methyl-2-oxo-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-5-carbothioamide (PubChem CID 3881437) has the molecular formula C19H17ClN4OS and a molecular weight of 384.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-14-methyl-2-oxo-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-5-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-14-methyl-2-oxo-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-5-carbothioamide |
|---|---|
| PubChem CID | 3881437 |
| Molecular Formula | C19H17ClN4OS |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-(4-chlorophenyl)-14-methyl-2-oxo-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-5-carbothioamide |
| SMILES | Cc1cccc2nc3c(c(=O)n12)CN(C(=S)Nc1ccc(Cl)cc1)CC3 |
| InChI | InChI=1S/C19H17ClN4OS/c1-12-3-2-4-17-22-16-9-10-23(11-15(16)18(25)24(12)17)19(26)21-14-7-5-13(20)6-8-14/h2-8H,9-11H2,1H3,(H,21,26) |
| InChIKey | SSMHGDHWYGRUTP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|