C15H18N4S — CID 54775678
1,2-dimethyl-N-phenyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carbothioamide (PubChem CID 54775678) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 1,2-dimethyl-N-phenyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carbothioamide.
| Compound Name | 1,2-dimethyl-N-phenyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 54775678 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1,2-dimethyl-N-phenyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carbothioamide |
| SMILES | Cc1nc2c(n1C)CCN(C(=S)Nc1ccccc1)C2 |
| InChI | InChI=1S/C15H18N4S/c1-11-16-13-10-19(9-8-14(13)18(11)2)15(20)17-12-6-4-3-5-7-12/h3-7H,8-10H2,1-2H3,(H,17,20) |
| InChIKey | ICULCFOSHLKPEM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|