C21H15ClF3N3O5S2 — CID 5093026
N-[4-[5-(4-chlorophenyl)sulfanyl-2-nitro-4-(trifluoromethylsulfonyl)anilino]phenyl]acetamide (PubChem CID 5093026) has the molecular formula C21H15ClF3N3O5S2 and a molecular weight of 545.95 g/mol. Its IUPAC name is N-[4-[5-(4-chlorophenyl)sulfanyl-2-nitro-4-(trifluoromethylsulfonyl)anilino]phenyl]acetamide.
| Compound Name | N-[4-[5-(4-chlorophenyl)sulfanyl-2-nitro-4-(trifluoromethylsulfonyl)anilino]phenyl]acetamide |
|---|---|
| PubChem CID | 5093026 |
| Molecular Formula | C21H15ClF3N3O5S2 |
| Molecular Weight | 545.95 g/mol |
| Exact Mass | 545.01 |
| IUPAC Name | N-[4-[5-(4-chlorophenyl)sulfanyl-2-nitro-4-(trifluoromethylsulfonyl)anilino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2cc(Sc3ccc(Cl)cc3)c(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H15ClF3N3O5S2/c1-12(29)26-14-4-6-15(7-5-14)27-17-10-19(34-16-8-2-13(22)3-9-16)20(11-18(17)28(30)31)35(32,33)21(23,24)25/h2-11,27H,1H3,(H,26,29) |
| InChIKey | JBQSUMQRZOWLDJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.95 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|