C25H28Cl2NOP — CID 50930527
(1R)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-bis[(Z)-2-chloro-2-phenylethenyl]phosphorylethanamine (PubChem CID 50930527) has the molecular formula C25H28Cl2NOP and a molecular weight of 460.39 g/mol. Its IUPAC name is (1R)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-bis[(Z)-2-chloro-2-phenylethenyl]phosphorylethanamine.
| Compound Name | (1R)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-bis[(Z)-2-chloro-2-phenylethenyl]phosphorylethanamine |
|---|---|
| PubChem CID | 50930527 |
| Molecular Formula | C25H28Cl2NOP |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (1R)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-bis[(Z)-2-chloro-2-phenylethenyl]phosphorylethanamine |
| SMILES | C[C@@H](NP(=O)(/C=C(\Cl)c1ccccc1)/C=C(\Cl)c1ccccc1)[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C25H28Cl2NOP/c1-18(23-15-19-12-13-22(23)14-19)28-30(29,16-24(26)20-8-4-2-5-9-20)17-25(27)21-10-6-3-7-11-21/h2-11,16-19,22-23H,12-15H2,1H3,(H,28,29)/b24-16-,25-17-/t18-,19-,22+,23-/m1/s1 |
| InChIKey | GZELMMQFHZYUJO-OBBIBTBCSA-N |
| XLogP | 8.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|