About CID 50934435
CID 50934435 (PubChem CID 50934435) has the molecular formula C6H20CoN10
and a molecular weight of 291.23 g/mol.
Molecular Properties
| Compound Name | CID 50934435 |
| PubChem CID | 50934435 |
| Molecular Formula | C6H20CoN10 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | — |
| SMILES | NCCN(CCN)CCN.[Co].[N-]=[N+]=N.[N-]=[N+]=N |
| InChI | InChI=1S/C6H18N4.Co.2HN3/c7-1-4-10(5-2-8)6-3-9;;2*1-3-2/h1-9H2;;2*1H |
| InChIKey | GQRAGEHVAIJKSJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 201.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze CID 50934435 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 50934435?
The IUPAC name of CID 50934435 (CID 50934435) is not available.
What is the SMILES notation for CID 50934435?
The canonical SMILES for CID 50934435 is NCCN(CCN)CCN.[Co].[N-]=[N+]=N.[N-]=[N+]=N.
What is the InChIKey of CID 50934435?
The InChIKey is GQRAGEHVAIJKSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N4.Co.2HN3/c7-1-4-10(5-2-8)6-3-9;;2*1-3-2/h1-9H2;;2*1H.
What are the key properties of CID 50934435?
CID 50934435 has a molecular weight of 291.23 g/mol, XLogP of -0.09, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 50934435 is sourced from PubChem (CID 50934435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).