C6H21Cl3N4O12 — CID 71341920
N',N'-bis(2-aminoethyl)ethane-1,2-diamine;perchloric acid (PubChem CID 71341920) has the molecular formula C6H21Cl3N4O12 and a molecular weight of 447.61 g/mol. Its IUPAC name is N',N'-bis(2-aminoethyl)ethane-1,2-diamine;perchloric acid.
| Compound Name | N',N'-bis(2-aminoethyl)ethane-1,2-diamine;perchloric acid |
|---|---|
| PubChem CID | 71341920 |
| Molecular Formula | C6H21Cl3N4O12 |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | N',N'-bis(2-aminoethyl)ethane-1,2-diamine;perchloric acid |
| SMILES | NCCN(CCN)CCN.[O-][Cl+3]([O-])([O-])O.[O-][Cl+3]([O-])([O-])O.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C6H18N4.3ClHO4/c7-1-4-10(5-2-8)6-3-9;3*2-1(3,4)5/h1-9H2;3*(H,2,3,4,5) |
| InChIKey | NLGXAYBVGOAKPA-UHFFFAOYSA-N |
| XLogP | -14.21 |
| TPSA | 349.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | -14.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |