C17H25O3- — CID 50936616
(2R)-2-[(E)-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]hexanoate (PubChem CID 50936616) has the molecular formula C17H25O3- and a molecular weight of 277.38 g/mol. Its IUPAC name is (2R)-2-[(E)-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]hexanoate.
| Compound Name | (2R)-2-[(E)-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]hexanoate |
|---|---|
| PubChem CID | 50936616 |
| Molecular Formula | C17H25O3- |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (2R)-2-[(E)-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]hexanoate |
| SMILES | CCCC[C@H](/C=C1/C(=O)[C@@]2(C)CC[C@@H]1C2(C)C)C(=O)[O-] |
| InChI | InChI=1S/C17H26O3/c1-5-6-7-11(15(19)20)10-12-13-8-9-17(4,14(12)18)16(13,2)3/h10-11,13H,5-9H2,1-4H3,(H,19,20)/p-1/b12-10+/t11-,13+,17-/m1/s1 |
| InChIKey | RRUIXALRRZOOAM-NBGCJWESSA-M |
| XLogP | 2.49 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|