C22H28O3 — CID 124527942
ethyl (2R,3E)-2-benzyl-3-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]propanoate (PubChem CID 124527942) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is ethyl (2R,3E)-2-benzyl-3-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]propanoate.
| Compound Name | ethyl (2R,3E)-2-benzyl-3-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]propanoate |
|---|---|
| PubChem CID | 124527942 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | ethyl (2R,3E)-2-benzyl-3-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]propanoate |
| SMILES | CCOC(=O)[C@@H](/C=C1/C(=O)[C@@]2(C)CC[C@H]1C2(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C22H28O3/c1-5-25-20(24)16(13-15-9-7-6-8-10-15)14-17-18-11-12-22(4,19(17)23)21(18,2)3/h6-10,14,16,18H,5,11-13H2,1-4H3/b17-14+/t16-,18-,22-/m1/s1 |
| InChIKey | LCUQLCGQFVMZFD-MLDQWQRBSA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|