C26H28O3 — CID 122405407
phenyl (2S,3Z)-2-benzyl-3-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]propanoate (PubChem CID 122405407) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is phenyl (2S,3Z)-2-benzyl-3-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]propanoate.
| Compound Name | phenyl (2S,3Z)-2-benzyl-3-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]propanoate |
|---|---|
| PubChem CID | 122405407 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | phenyl (2S,3Z)-2-benzyl-3-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]propanoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)/C2=C\[C@H](Cc1ccccc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C26H28O3/c1-25(2)22-14-15-26(25,3)23(27)21(22)17-19(16-18-10-6-4-7-11-18)24(28)29-20-12-8-5-9-13-20/h4-13,17,19,22H,14-16H2,1-3H3/b21-17-/t19-,22-,26+/m0/s1 |
| InChIKey | UTUGYCPSXHQSSU-ZCGKHYAMSA-N |
| XLogP | 5.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|