About 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide
2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide (PubChem CID 175791693) has the molecular formula C21H25NO2
and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide.
Molecular Properties
| Compound Name | 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide |
| PubChem CID | 175791693 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide |
| SMILES | CC12CCC(C(=CC=C(Cc3ccccc3)C(N)=O)C1=O)C2(C)C |
| InChI | InChI=1S/C21H25NO2/c1-20(2)17-11-12-21(20,3)18(23)16(17)10-9-15(19(22)24)13-14-7-5-4-6-8-14/h4-10,17H,11-13H2,1-3H3,(H2,22,24) |
| InChIKey | WEUKWPSYMVWFLX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide?
The IUPAC name of 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide (CID 175791693) is 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide.
What is the SMILES notation for 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide?
The canonical SMILES for 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide is CC12CCC(C(=CC=C(Cc3ccccc3)C(N)=O)C1=O)C2(C)C.
What is the InChIKey of 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide?
The InChIKey is WEUKWPSYMVWFLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2/c1-20(2)17-11-12-21(20,3)18(23)16(17)10-9-15(19(22)24)13-14-7-5-4-6-8-14/h4-10,17H,11-13H2,1-3H3,(H2,22,24).
What are the key properties of 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide?
2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide has a molecular weight of 323.44 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)but-2-enamide is sourced from PubChem (CID 175791693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).