C15H20O5 — CID 124767775
(2S)-2-[(Z)-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]butanedioic acid (PubChem CID 124767775) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2S)-2-[(Z)-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]butanedioic acid.
| Compound Name | (2S)-2-[(Z)-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]butanedioic acid |
|---|---|
| PubChem CID | 124767775 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (2S)-2-[(Z)-[(1R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]butanedioic acid |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)/C2=C\[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H20O5/c1-14(2)10-4-5-15(14,3)12(18)9(10)6-8(13(19)20)7-11(16)17/h6,8,10H,4-5,7H2,1-3H3,(H,16,17)(H,19,20)/b9-6-/t8-,10+,15-/m1/s1 |
| InChIKey | FAIFKXVFDPTYBI-MXSDIXFVSA-N |
| XLogP | 2.11 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|