C19H23ClN2O3 — CID 50938654
3-[1-(3-chlorophenyl)-4-(cyclohexylamino)-5-oxo-2H-pyrrol-3-yl]propanoic acid (PubChem CID 50938654) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is 3-[1-(3-chlorophenyl)-4-(cyclohexylamino)-5-oxo-2H-pyrrol-3-yl]propanoic acid.
| Compound Name | 3-[1-(3-chlorophenyl)-4-(cyclohexylamino)-5-oxo-2H-pyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 50938654 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-[1-(3-chlorophenyl)-4-(cyclohexylamino)-5-oxo-2H-pyrrol-3-yl]propanoic acid |
| SMILES | O=C(O)CCC1=C(NC2CCCCC2)C(=O)N(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H23ClN2O3/c20-14-5-4-8-16(11-14)22-12-13(9-10-17(23)24)18(19(22)25)21-15-6-2-1-3-7-15/h4-5,8,11,15,21H,1-3,6-7,9-10,12H2,(H,23,24) |
| InChIKey | DSCWTUAMHKHGGW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |