C19H30O7 — CID 50938869
[(3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-5-methylhex-2-enoate (PubChem CID 50938869) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is [(3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-5-methylhex-2-enoate.
| Compound Name | [(3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-5-methylhex-2-enoate |
|---|---|
| PubChem CID | 50938869 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-5-methylhex-2-enoate |
| SMILES | CC(C)C/C=C/C(=O)O[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H30O7/c1-11(2)8-7-9-13(20)22-15-14(12-10-21-18(3,4)24-12)23-17-16(15)25-19(5,6)26-17/h7,9,11-12,14-17H,8,10H2,1-6H3/b9-7+/t12-,14-,15-,16-,17-/m1/s1 |
| InChIKey | RCAUKRIDGYKXOL-SISCQJPRSA-N |
| XLogP | 2.53 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|