C15H20O7 — CID 135022250
(3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-furan]-2'-one (PubChem CID 135022250) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-furan]-2'-one.
| Compound Name | (3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-furan]-2'-one |
|---|---|
| PubChem CID | 135022250 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-furan]-2'-one |
| SMILES | CC1(C)OC[C@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@@]23C=CC(=O)O3)O1 |
| InChI | InChI=1S/C15H20O7/c1-13(2)17-7-8(19-13)10-15(6-5-9(16)20-15)11-12(18-10)22-14(3,4)21-11/h5-6,8,10-12H,7H2,1-4H3/t8-,10-,11+,12-,15-/m1/s1 |
| InChIKey | PDNNHHXQTAKWLH-RZJSXJPMSA-N |
| XLogP | 0.87 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |