C19H29FO7 — CID 101252393
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-2-fluoro-5-methylhex-2-enoate (PubChem CID 101252393) has the molecular formula C19H29FO7 and a molecular weight of 388.43 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-2-fluoro-5-methylhex-2-enoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-2-fluoro-5-methylhex-2-enoate |
|---|---|
| PubChem CID | 101252393 |
| Molecular Formula | C19H29FO7 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-2-fluoro-5-methylhex-2-enoate |
| SMILES | CC(C)C/C=C(/F)C(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H29FO7/c1-10(2)7-8-11(20)16(21)23-14-13(12-9-22-18(3,4)25-12)24-17-15(14)26-19(5,6)27-17/h8,10,12-15,17H,7,9H2,1-6H3/b11-8+/t12-,13-,14+,15-,17-/m1/s1 |
| InChIKey | UUYLNUYKOQKYAJ-ZPLJMJJWSA-N |
| XLogP | 2.83 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|