C22H34O7 — CID 10501728
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 5-methyl-2-propan-2-ylidenehex-4-enoate (PubChem CID 10501728) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 5-methyl-2-propan-2-ylidenehex-4-enoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 5-methyl-2-propan-2-ylidenehex-4-enoate |
|---|---|
| PubChem CID | 10501728 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 5-methyl-2-propan-2-ylidenehex-4-enoate |
| SMILES | CC(C)=CCC(C(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1)=C(C)C |
| InChI | InChI=1S/C22H34O7/c1-12(2)9-10-14(13(3)4)19(23)25-17-16(15-11-24-21(5,6)27-15)26-20-18(17)28-22(7,8)29-20/h9,15-18,20H,10-11H2,1-8H3/t15-,16-,17+,18-,20-/m1/s1 |
| InChIKey | YHXHMOYLUIXHQR-BFMVXSJESA-N |
| XLogP | 3.62 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|